C12H11B4FN4 — CID 174079036
CID 174079036 (PubChem CID 174079036) has the molecular formula C12H11B4FN4 and a molecular weight of 273.49 g/mol.
| Compound Name | CID 174079036 |
|---|---|
| PubChem CID | 174079036 |
| Molecular Formula | C12H11B4FN4 |
| Molecular Weight | 273.49 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | — |
| SMILES | [B]C1([B])CC(c2cn3ncnc3c(F)c2C)CC([B])([B])N1 |
| InChI | InChI=1S/C12H11B4FN4/c1-6-8(4-21-10(9(6)17)18-5-19-21)7-2-11(13,14)20-12(15,16)3-7/h4-5,7,20H,2-3H2,1H3 |
| InChIKey | KCNFGFWJBILJDQ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.49 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|