C17H15B4N7O2S — CID 174079155
CID 174079155 (PubChem CID 174079155) has the molecular formula C17H15B4N7O2S and a molecular weight of 424.67 g/mol.
| Compound Name | CID 174079155 |
|---|---|
| PubChem CID | 174079155 |
| Molecular Formula | C17H15B4N7O2S |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | — |
| SMILES | [B]C1([B])CC(c2cn3ncnc3cc2C)CC([B])([B])N1S(=O)(=O)c1cnn(C)c1C#N |
| InChI | InChI=1S/C17H15B4N7O2S/c1-10-3-15-23-9-25-27(15)8-12(10)11-4-16(18,19)28(17(20,21)5-11)31(29,30)14-7-24-26(2)13(14)6-22/h3,7-9,11H,4-5H2,1-2H3 |
| InChIKey | NOGJVPRVXWYABF-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 109.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|