C17H19ClFN3O3S — CID 17408314
2-(4-chloro-2-fluoro-N-methylsulfonylanilino)-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 17408314) has the molecular formula C17H19ClFN3O3S and a molecular weight of 399.88 g/mol. Its IUPAC name is 2-(4-chloro-2-fluoro-N-methylsulfonylanilino)-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-(4-chloro-2-fluoro-N-methylsulfonylanilino)-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 17408314 |
| Molecular Formula | C17H19ClFN3O3S |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 2-(4-chloro-2-fluoro-N-methylsulfonylanilino)-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | CN(C)c1ccc(NC(=O)CN(c2ccc(Cl)cc2F)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H19ClFN3O3S/c1-21(2)14-7-5-13(6-8-14)20-17(23)11-22(26(3,24)25)16-9-4-12(18)10-15(16)19/h4-10H,11H2,1-3H3,(H,20,23) |
| InChIKey | RBVUTICVIBGXRJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|