C39H41BN6O4 — CID 174084462
CID 174084462 (PubChem CID 174084462) has the molecular formula C39H41BN6O4 and a molecular weight of 668.61 g/mol.
| Compound Name | CID 174084462 |
|---|---|
| PubChem CID | 174084462 |
| Molecular Formula | C39H41BN6O4 |
| Molecular Weight | 668.61 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | — |
| SMILES | [B]C1(N)C2CCC1N(C(=O)c1cc(OC)c3c(c1)nc(-c1cc4ccccc4n1CC1CC1)n3CC1CN(C(=O)c3ccccc3OC)C1)C2 |
| InChI | InChI=1S/C39H41BN6O4/c1-49-32-10-6-4-8-28(32)38(48)43-18-24(19-43)21-46-35-29(42-36(46)31-16-25-7-3-5-9-30(25)44(31)20-23-11-12-23)15-26(17-33(35)50-2)37(47)45-22-27-13-14-34(45)39(27,40)41/h3-10,15-17,23-24,27,34H,11-14,18-22,41H2,1-2H3 |
| InChIKey | CBCCHUFEJZTJAA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|