C26H24FN3O2S — CID 17408820
3-[1-[2-[(2-fluorophenyl)methylsulfanyl]benzoyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 17408820) has the molecular formula C26H24FN3O2S and a molecular weight of 461.56 g/mol. Its IUPAC name is 3-[1-[2-[(2-fluorophenyl)methylsulfanyl]benzoyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[2-[(2-fluorophenyl)methylsulfanyl]benzoyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 17408820 |
| Molecular Formula | C26H24FN3O2S |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 3-[1-[2-[(2-fluorophenyl)methylsulfanyl]benzoyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=C(c1ccccc1SCc1ccccc1F)N1CCC(n2c(=O)[nH]c3ccccc32)CC1 |
| InChI | InChI=1S/C26H24FN3O2S/c27-21-9-3-1-7-18(21)17-33-24-12-6-2-8-20(24)25(31)29-15-13-19(14-16-29)30-23-11-5-4-10-22(23)28-26(30)32/h1-12,19H,13-17H2,(H,28,32) |
| InChIKey | RCILPBIEHYIWOF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |