C21H26F6N4O4 — CID 174088823
2,2,2-trifluoro-N-[(1S,2S,6S,8R,12S,17S)-2-methyl-5,11,19-trioxo-8-(trifluoromethyl)-4,10,18-triazatricyclo[15.2.1.06,10]icos-15-en-12-yl]acetamide (PubChem CID 174088823) has the molecular formula C21H26F6N4O4 and a molecular weight of 512.45 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1S,2S,6S,8R,12S,17S)-2-methyl-5,11,19-trioxo-8-(trifluoromethyl)-4,10,18-triazatricyclo[15.2.1.06,10]icos-15-en-12-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1S,2S,6S,8R,12S,17S)-2-methyl-5,11,19-trioxo-8-(trifluoromethyl)-4,10,18-triazatricyclo[15.2.1.06,10]icos-15-en-12-yl]acetamide |
|---|---|
| PubChem CID | 174088823 |
| Molecular Formula | C21H26F6N4O4 |
| Molecular Weight | 512.45 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1S,2S,6S,8R,12S,17S)-2-methyl-5,11,19-trioxo-8-(trifluoromethyl)-4,10,18-triazatricyclo[15.2.1.06,10]icos-15-en-12-yl]acetamide |
| SMILES | C[C@@H]1CNC(=O)[C@@H]2C[C@@H](C(F)(F)F)CN2C(=O)[C@@H](NC(=O)C(F)(F)F)CCC=C[C@@H]2C[C@@H]1C(=O)N2 |
| InChI | InChI=1S/C21H26F6N4O4/c1-10-8-28-17(33)15-6-11(20(22,23)24)9-31(15)18(34)14(30-19(35)21(25,26)27)5-3-2-4-12-7-13(10)16(32)29-12/h2,4,10-15H,3,5-9H2,1H3,(H,28,33)(H,29,32)(H,30,35)/t10-,11-,12-,13+,14+,15+/m1/s1 |
| InChIKey | UDYZWRWJZHVDLS-JNWWKETESA-N |
| XLogP | 1.42 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|