C9H18N2O2 — CID 174090103
1-[(1R)-1-[(4R)-1,3-dioxolan-4-yl]ethyl]piperazine (PubChem CID 174090103) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 1-[(1R)-1-[(4R)-1,3-dioxolan-4-yl]ethyl]piperazine.
| Compound Name | 1-[(1R)-1-[(4R)-1,3-dioxolan-4-yl]ethyl]piperazine |
|---|---|
| PubChem CID | 174090103 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-[(1R)-1-[(4R)-1,3-dioxolan-4-yl]ethyl]piperazine |
| SMILES | C[C@H]([C@@H]1COCO1)N1CCNCC1 |
| InChI | InChI=1S/C9H18N2O2/c1-8(9-6-12-7-13-9)11-4-2-10-3-5-11/h8-10H,2-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | LNRDZWWZFATBQB-BDAKNGLRSA-N |
| XLogP | -0.35 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |