C10H20N2O2 — CID 67205042
1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]piperazine (PubChem CID 67205042) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]piperazine.
| Compound Name | 1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]piperazine |
|---|---|
| PubChem CID | 67205042 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 1-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]piperazine |
| SMILES | CC1(C)OC[C@H](CN2CCNCC2)O1 |
| InChI | InChI=1S/C10H20N2O2/c1-10(2)13-8-9(14-10)7-12-5-3-11-4-6-12/h9,11H,3-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | CUTBQYOJWOSAHD-VIFPVBQESA-N |
| XLogP | 0.04 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |