C36H57N3O11Si4 — CID 174091269
[5-benzoyl-2-(methoxycarbonylamino)benzimidazol-1-yl]methyl [(3S)-3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl carbonate (PubChem CID 174091269) has the molecular formula C36H57N3O11Si4 and a molecular weight of 820.21 g/mol. Its IUPAC name is [5-benzoyl-2-(methoxycarbonylamino)benzimidazol-1-yl]methyl [(3S)-3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl carbonate.
| Compound Name | [5-benzoyl-2-(methoxycarbonylamino)benzimidazol-1-yl]methyl [(3S)-3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 174091269 |
| Molecular Formula | C36H57N3O11Si4 |
| Molecular Weight | 820.21 g/mol |
| Exact Mass | 819.31 |
| IUPAC Name | [5-benzoyl-2-(methoxycarbonylamino)benzimidazol-1-yl]methyl [(3S)-3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl carbonate |
| SMILES | COC(=O)Nc1nc2cc(C(=O)c3ccccc3)ccc2n1COC(=O)OCC1OC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C36H57N3O11Si4/c1-43-35(41)38-34-37-26-21-25(29(40)24-17-15-14-16-18-24)19-20-27(26)39(34)23-45-36(42)44-22-28-30(47-51(2,3)4)31(48-52(5,6)7)32(49-53(8,9)10)33(46-28)50-54(11,12)13/h14-21,28,30-33H,22-23H2,1-13H3,(H,37,38,41)/t28?,30-,31?,32?,33?/m0/s1 |
| InChIKey | XLGVBGWKAXJTGR-PUILGXJISA-N |
| XLogP | 7.79 |
| TPSA | 154.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.21 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|