C23H27N3O9 — CID 153334805
[5-benzoyl-2-(methylamino)benzimidazol-1-yl]methyl [3-hydroxy-2-(1,2,2-trihydroxyethoxy)butyl] carbonate (PubChem CID 153334805) has the molecular formula C23H27N3O9 and a molecular weight of 489.48 g/mol. Its IUPAC name is [5-benzoyl-2-(methylamino)benzimidazol-1-yl]methyl [3-hydroxy-2-(1,2,2-trihydroxyethoxy)butyl] carbonate.
| Compound Name | [5-benzoyl-2-(methylamino)benzimidazol-1-yl]methyl [3-hydroxy-2-(1,2,2-trihydroxyethoxy)butyl] carbonate |
|---|---|
| PubChem CID | 153334805 |
| Molecular Formula | C23H27N3O9 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | [5-benzoyl-2-(methylamino)benzimidazol-1-yl]methyl [3-hydroxy-2-(1,2,2-trihydroxyethoxy)butyl] carbonate |
| SMILES | CNc1nc2cc(C(=O)c3ccccc3)ccc2n1COC(=O)OCC(OC(O)C(O)O)C(C)O |
| InChI | InChI=1S/C23H27N3O9/c1-13(27)18(35-21(31)20(29)30)11-33-23(32)34-12-26-17-9-8-15(10-16(17)25-22(26)24-2)19(28)14-6-4-3-5-7-14/h3-10,13,18,20-21,27,29-31H,11-12H2,1-2H3,(H,24,25) |
| InChIKey | DNQFEMKWVPDKMX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 172.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|