C25H20N4O3 — CID 23242066
2-(6-benzoyl-3-methyl-2-oxoquinoxalin-1-yl)-N-(benzylideneamino)acetamide (PubChem CID 23242066) has the molecular formula C25H20N4O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is 2-(6-benzoyl-3-methyl-2-oxoquinoxalin-1-yl)-N-(benzylideneamino)acetamide.
| Compound Name | 2-(6-benzoyl-3-methyl-2-oxoquinoxalin-1-yl)-N-(benzylideneamino)acetamide |
|---|---|
| PubChem CID | 23242066 |
| Molecular Formula | C25H20N4O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-(6-benzoyl-3-methyl-2-oxoquinoxalin-1-yl)-N-(benzylideneamino)acetamide |
| SMILES | Cc1nc2cc(C(=O)c3ccccc3)ccc2n(CC(=O)NN=Cc2ccccc2)c1=O |
| InChI | InChI=1S/C25H20N4O3/c1-17-25(32)29(16-23(30)28-26-15-18-8-4-2-5-9-18)22-13-12-20(14-21(22)27-17)24(31)19-10-6-3-7-11-19/h2-15H,16H2,1H3,(H,28,30) |
| InChIKey | UYOYFIDCMRZNQP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|