C17H19N5OS — CID 174091542
3-amino-3-[4-(ethylsulfanylamino)phenyl]-2-formyl-N'-pyridin-2-ylprop-2-enimidamide (PubChem CID 174091542) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is 3-amino-3-[4-(ethylsulfanylamino)phenyl]-2-formyl-N'-pyridin-2-ylprop-2-enimidamide.
| Compound Name | 3-amino-3-[4-(ethylsulfanylamino)phenyl]-2-formyl-N'-pyridin-2-ylprop-2-enimidamide |
|---|---|
| PubChem CID | 174091542 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 3-amino-3-[4-(ethylsulfanylamino)phenyl]-2-formyl-N'-pyridin-2-ylprop-2-enimidamide |
| SMILES | CCSNc1ccc(C(N)=C(C=O)C(N)=Nc2ccccn2)cc1 |
| InChI | InChI=1S/C17H19N5OS/c1-2-24-22-13-8-6-12(7-9-13)16(18)14(11-23)17(19)21-15-5-3-4-10-20-15/h3-11,22H,2,18H2,1H3,(H2,19,20,21) |
| InChIKey | CGHMLGJRZNPKPJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|