C18H17N5 — CID 24939669
1-(4-methylphenyl)-2,3-dipyridin-2-ylguanidine (PubChem CID 24939669) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2,3-dipyridin-2-ylguanidine.
| Compound Name | 1-(4-methylphenyl)-2,3-dipyridin-2-ylguanidine |
|---|---|
| PubChem CID | 24939669 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 1-(4-methylphenyl)-2,3-dipyridin-2-ylguanidine |
| SMILES | Cc1ccc(N/C(=N/c2ccccn2)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C18H17N5/c1-14-8-10-15(11-9-14)21-18(22-16-6-2-4-12-19-16)23-17-7-3-5-13-20-17/h2-13H,1H3,(H2,19,20,21,22,23) |
| InChIKey | KCCBDZMUBOPAFT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|