C23H20BClN6S — CID 174094778
CID 174094778 (PubChem CID 174094778) has the molecular formula C23H20BClN6S and a molecular weight of 458.79 g/mol.
| Compound Name | CID 174094778 |
|---|---|
| PubChem CID | 174094778 |
| Molecular Formula | C23H20BClN6S |
| Molecular Weight | 458.79 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | — |
| SMILES | [B]c1cc(Sc2cnc(N3CCC4(CC3)Cc3cccnc3C4)n3ccnc23)c(Cl)cn1 |
| InChI | InChI=1S/C23H20BClN6S/c24-20-10-18(16(25)13-28-20)32-19-14-29-22(31-9-6-27-21(19)31)30-7-3-23(4-8-30)11-15-2-1-5-26-17(15)12-23/h1-2,5-6,9-10,13-14H,3-4,7-8,11-12H2 |
| InChIKey | PEVAWQJNRVYIDN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.79 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|