C13H18N4O3 — CID 174097987
ethyl 3-amino-2-(4-morpholin-4-ylpyrimidin-2-yl)prop-2-enoate (PubChem CID 174097987) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is ethyl 3-amino-2-(4-morpholin-4-ylpyrimidin-2-yl)prop-2-enoate.
| Compound Name | ethyl 3-amino-2-(4-morpholin-4-ylpyrimidin-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 174097987 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | ethyl 3-amino-2-(4-morpholin-4-ylpyrimidin-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)C(=CN)c1nccc(N2CCOCC2)n1 |
| InChI | InChI=1S/C13H18N4O3/c1-2-20-13(18)10(9-14)12-15-4-3-11(16-12)17-5-7-19-8-6-17/h3-4,9H,2,5-8,14H2,1H3 |
| InChIKey | UOVIPKNZAMSOHF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|