C9H14N2O — CID 174098221
(4aS,7S)-7-ethenyl-3,4,4a,5,6,7-hexahydro-2H-pyrrolo[1,2-c]pyrimidin-1-one (PubChem CID 174098221) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (4aS,7S)-7-ethenyl-3,4,4a,5,6,7-hexahydro-2H-pyrrolo[1,2-c]pyrimidin-1-one.
| Compound Name | (4aS,7S)-7-ethenyl-3,4,4a,5,6,7-hexahydro-2H-pyrrolo[1,2-c]pyrimidin-1-one |
|---|---|
| PubChem CID | 174098221 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (4aS,7S)-7-ethenyl-3,4,4a,5,6,7-hexahydro-2H-pyrrolo[1,2-c]pyrimidin-1-one |
| SMILES | C=C[C@@H]1CC[C@H]2CCNC(=O)N21 |
| InChI | InChI=1S/C9H14N2O/c1-2-7-3-4-8-5-6-10-9(12)11(7)8/h2,7-8H,1,3-6H2,(H,10,12)/t7-,8+/m1/s1 |
| InChIKey | XHIZJDSUNPOQPG-SFYZADRCSA-N |
| XLogP | 1.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|