C13H28N2O3S — CID 174098827
[1-(dimethylamino)-6,6-dimethylnonylidene]sulfamic acid (PubChem CID 174098827) has the molecular formula C13H28N2O3S and a molecular weight of 292.44 g/mol. Its IUPAC name is [1-(dimethylamino)-6,6-dimethylnonylidene]sulfamic acid.
| Compound Name | [1-(dimethylamino)-6,6-dimethylnonylidene]sulfamic acid |
|---|---|
| PubChem CID | 174098827 |
| Molecular Formula | C13H28N2O3S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | [1-(dimethylamino)-6,6-dimethylnonylidene]sulfamic acid |
| SMILES | CCCC(C)(C)CCCCC(=NS(=O)(=O)O)N(C)C |
| InChI | InChI=1S/C13H28N2O3S/c1-6-10-13(2,3)11-8-7-9-12(15(4)5)14-19(16,17)18/h6-11H2,1-5H3,(H,16,17,18) |
| InChIKey | XCHJLUZYYHMTMW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|