C8H19N3O2S — CID 126717465
N,N-dimethyl-N'-sulfamoylhexanimidamide (PubChem CID 126717465) has the molecular formula C8H19N3O2S and a molecular weight of 221.33 g/mol. Its IUPAC name is N,N-dimethyl-N'-sulfamoylhexanimidamide.
| Compound Name | N,N-dimethyl-N'-sulfamoylhexanimidamide |
|---|---|
| PubChem CID | 126717465 |
| Molecular Formula | C8H19N3O2S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N,N-dimethyl-N'-sulfamoylhexanimidamide |
| SMILES | CCCCC/C(=N/S(N)(=O)=O)N(C)C |
| InChI | InChI=1S/C8H19N3O2S/c1-4-5-6-7-8(11(2)3)10-14(9,12)13/h4-7H2,1-3H3,(H2,9,12,13)/b10-8- |
| InChIKey | JEOAIXBFJCKTSD-NTMALXAHSA-N |
| XLogP | 0.73 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|