C40H82N4O4S — CID 174137835
heptadecan-9-yl 8-[[5-(dimethylamino)-5-sulfamoyliminopentyl]-octylamino]octanoate (PubChem CID 174137835) has the molecular formula C40H82N4O4S and a molecular weight of 715.19 g/mol. Its IUPAC name is heptadecan-9-yl 8-[[5-(dimethylamino)-5-sulfamoyliminopentyl]-octylamino]octanoate.
| Compound Name | heptadecan-9-yl 8-[[5-(dimethylamino)-5-sulfamoyliminopentyl]-octylamino]octanoate |
|---|---|
| PubChem CID | 174137835 |
| Molecular Formula | C40H82N4O4S |
| Molecular Weight | 715.19 g/mol |
| Exact Mass | 714.61 |
| IUPAC Name | heptadecan-9-yl 8-[[5-(dimethylamino)-5-sulfamoyliminopentyl]-octylamino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC)CCCCC(=NS(N)(=O)=O)N(C)C |
| InChI | InChI=1S/C40H82N4O4S/c1-6-9-12-15-19-24-31-38(32-25-20-16-13-10-7-2)48-40(45)34-26-21-18-23-29-36-44(35-28-22-17-14-11-8-3)37-30-27-33-39(43(4)5)42-49(41,46)47/h38H,6-37H2,1-5H3,(H2,41,46,47) |
| InChIKey | MDZMLJZOUINOKD-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.19 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|