C45H22B6N4S — CID 174100717
CID 174100717 (PubChem CID 174100717) has the molecular formula C45H22B6N4S and a molecular weight of 715.64 g/mol.
| Compound Name | CID 174100717 |
|---|---|
| PubChem CID | 174100717 |
| Molecular Formula | C45H22B6N4S |
| Molecular Weight | 715.64 g/mol |
| Exact Mass | 716.21 |
| IUPAC Name | — |
| SMILES | [B]c1cc([B])c2sc3c([B])c([B])c4c5cc([B])cc([B])c5n(-c5cccc(-c6nc(-c7ccccc7)nc(-c7cccc(-c8ccccc8)c7)n6)c5)c4c3c2c1 |
| InChI | InChI=1S/C45H22B6N4S/c46-28-19-31-35-37(50)38(51)42-36(32-20-29(47)22-34(49)41(32)56-42)40(35)55(39(31)33(48)21-28)30-16-8-15-27(18-30)45-53-43(24-11-5-2-6-12-24)52-44(54-45)26-14-7-13-25(17-26)23-9-3-1-4-10-23/h1-22H |
| InChIKey | PFQLWVVSWRQIJA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.64 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|