C23H26N4O5 — CID 17410122
N-[4-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylamino]methyl]phenyl]acetamide;oxalic acid (PubChem CID 17410122) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is N-[4-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylamino]methyl]phenyl]acetamide;oxalic acid.
| Compound Name | N-[4-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylamino]methyl]phenyl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 17410122 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-[4-[[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylamino]methyl]phenyl]acetamide;oxalic acid |
| SMILES | CC(=O)Nc1ccc(CNCc2c(C)nn(-c3ccccc3)c2C)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H24N4O.C2H2O4/c1-15-21(16(2)25(24-15)20-7-5-4-6-8-20)14-22-13-18-9-11-19(12-10-18)23-17(3)26;3-1(4)2(5)6/h4-12,22H,13-14H2,1-3H3,(H,23,26);(H,3,4)(H,5,6) |
| InChIKey | IDKMCIUOHILQES-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|