C22H22B3ClN2O4S — CID 174102059
CID 174102059 (PubChem CID 174102059) has the molecular formula C22H22B3ClN2O4S and a molecular weight of 478.38 g/mol.
| Compound Name | CID 174102059 |
|---|---|
| PubChem CID | 174102059 |
| Molecular Formula | C22H22B3ClN2O4S |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N1C(=O)C2(CCN(CCOc3ccc(S(C)(=O)=O)cc3)CC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H22B3ClN2O4S/c1-33(30,31)17-5-3-16(4-6-17)32-13-12-27-10-8-21(9-11-27)18-14-15(26)2-7-19(18)28(20(21)29)22(23,24)25/h2-7,14H,8-13H2,1H3 |
| InChIKey | LVTLOMHZIFZPQC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|