About CID 174102059
CID 174102059 (PubChem CID 174102059) has the molecular formula C22H22B3ClN2O4S
and a molecular weight of 478.38 g/mol.
Molecular Properties
| Compound Name | CID 174102059 |
| PubChem CID | 174102059 |
| Molecular Formula | C22H22B3ClN2O4S |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N1C(=O)C2(CCN(CCOc3ccc(S(C)(=O)=O)cc3)CC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H22B3ClN2O4S/c1-33(30,31)17-5-3-16(4-6-17)32-13-12-27-10-8-21(9-11-27)18-14-15(26)2-7-19(18)28(20(21)29)22(23,24)25/h2-7,14H,8-13H2,1H3 |
| InChIKey | LVTLOMHZIFZPQC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174102059 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174102059?
The IUPAC name of CID 174102059 (CID 174102059) is not available.
What is the SMILES notation for CID 174102059?
The canonical SMILES for CID 174102059 is [B]C([B])([B])N1C(=O)C2(CCN(CCOc3ccc(S(C)(=O)=O)cc3)CC2)c2cc(Cl)ccc21.
What is the InChIKey of CID 174102059?
The InChIKey is LVTLOMHZIFZPQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22B3ClN2O4S/c1-33(30,31)17-5-3-16(4-6-17)32-13-12-27-10-8-21(9-11-27)18-14-15(26)2-7-19(18)28(20(21)29)22(23,24)25/h2-7,14H,8-13H2,1H3.
What are the key properties of CID 174102059?
CID 174102059 has a molecular weight of 478.38 g/mol, XLogP of 1.62, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174102059 is sourced from PubChem (CID 174102059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).