C32H40Hf — CID 174105760
cyclopenta-1,3-diene;cyclopentylmethylidenehafnium(2+);2,7-ditert-butyl-9H-fluoren-9-ide (PubChem CID 174105760) has the molecular formula C32H40Hf and a molecular weight of 603.16 g/mol. Its IUPAC name is cyclopenta-1,3-diene;cyclopentylmethylidenehafnium(2+);2,7-ditert-butyl-9H-fluoren-9-ide.
| Compound Name | cyclopenta-1,3-diene;cyclopentylmethylidenehafnium(2+);2,7-ditert-butyl-9H-fluoren-9-ide |
|---|---|
| PubChem CID | 174105760 |
| Molecular Formula | C32H40Hf |
| Molecular Weight | 603.16 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | cyclopenta-1,3-diene;cyclopentylmethylidenehafnium(2+);2,7-ditert-butyl-9H-fluoren-9-ide |
| SMILES | CC(C)(C)c1ccc2c(c1)[cH-]c1cc(C(C)(C)C)ccc12.[Hf+2]=CC1CCCC1.c1cc[cH-]c1 |
| InChI | InChI=1S/C21H25.C6H10.C5H5.Hf/c1-20(2,3)16-7-9-18-14(12-16)11-15-13-17(21(4,5)6)8-10-19(15)18;1-6-4-2-3-5-6;1-2-4-5-3-1;/h7-13H,1-6H3;1,6H,2-5H2;1-5H;/q-1;;-1;+2 |
| InChIKey | CMROFSJTWYVEDG-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.16 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|