C17H21F2N4Si — CID 174109812
CID 174109812 (PubChem CID 174109812) has the molecular formula C17H21F2N4Si and a molecular weight of 347.47 g/mol.
| Compound Name | CID 174109812 |
|---|---|
| PubChem CID | 174109812 |
| Molecular Formula | C17H21F2N4Si |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | — |
| SMILES | CC(C)Nc1nc(C(F)F)cc2cnc(NC3CC[C@H]([Si])C3)cc12 |
| InChI | InChI=1S/C17H21F2N4Si/c1-9(2)21-17-13-7-15(22-11-3-4-12(24)6-11)20-8-10(13)5-14(23-17)16(18)19/h5,7-9,11-12,16H,3-4,6H2,1-2H3,(H,20,22)(H,21,23)/t11?,12-/m0/s1 |
| InChIKey | IUMYNRSPWATYDX-KIYNQFGBSA-N |
| XLogP | 4.31 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|