C22H26FN7 — CID 174111929
2-[(4-fluorophenyl)methyliminomethyl]-N'-(3,9,10-trimethyl-1,5,7,9-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl)prop-1-ene-1,3-diamine (PubChem CID 174111929) has the molecular formula C22H26FN7 and a molecular weight of 407.50 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyliminomethyl]-N'-(3,9,10-trimethyl-1,5,7,9-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl)prop-1-ene-1,3-diamine.
| Compound Name | 2-[(4-fluorophenyl)methyliminomethyl]-N'-(3,9,10-trimethyl-1,5,7,9-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl)prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 174111929 |
| Molecular Formula | C22H26FN7 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 2-[(4-fluorophenyl)methyliminomethyl]-N'-(3,9,10-trimethyl-1,5,7,9-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl)prop-1-ene-1,3-diamine |
| SMILES | Cc1cn2c3c(nc(NCC(=CN)/C=N/Cc4ccc(F)cc4)nc13)N(C)C(C)C2 |
| InChI | InChI=1S/C22H26FN7/c1-14-12-30-13-15(2)29(3)21-20(30)19(14)27-22(28-21)26-11-17(8-24)10-25-9-16-4-6-18(23)7-5-16/h4-8,10,12,15H,9,11,13,24H2,1-3H3,(H,26,27,28)/b17-8?,25-10+ |
| InChIKey | LTGKSLBUFKPKGR-VJIYYVFNSA-N |
| XLogP | 3.24 |
| TPSA | 84.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|