C34H34N8O3 — CID 174112123
N-[4-(3-cyanophenyl)-6-[2-[[6-[cyclopentyl(methoxy)methyl]-2-pyridinyl]methylimino]ethanehydrazonoyl]pyrimidin-2-yl]-2-phenoxyacetamide (PubChem CID 174112123) has the molecular formula C34H34N8O3 and a molecular weight of 602.70 g/mol. Its IUPAC name is N-[4-(3-cyanophenyl)-6-[2-[[6-[cyclopentyl(methoxy)methyl]-2-pyridinyl]methylimino]ethanehydrazonoyl]pyrimidin-2-yl]-2-phenoxyacetamide.
| Compound Name | N-[4-(3-cyanophenyl)-6-[2-[[6-[cyclopentyl(methoxy)methyl]-2-pyridinyl]methylimino]ethanehydrazonoyl]pyrimidin-2-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 174112123 |
| Molecular Formula | C34H34N8O3 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | N-[4-(3-cyanophenyl)-6-[2-[[6-[cyclopentyl(methoxy)methyl]-2-pyridinyl]methylimino]ethanehydrazonoyl]pyrimidin-2-yl]-2-phenoxyacetamide |
| SMILES | COC(c1cccc(C/N=C/C(=NN)c2cc(-c3cccc(C#N)c3)nc(NC(=O)COc3ccccc3)n2)n1)C1CCCC1 |
| InChI | InChI=1S/C34H34N8O3/c1-44-33(24-10-5-6-11-24)28-16-8-13-26(38-28)20-37-21-31(42-36)30-18-29(25-12-7-9-23(17-25)19-35)39-34(40-30)41-32(43)22-45-27-14-3-2-4-15-27/h2-4,7-9,12-18,21,24,33H,5-6,10-11,20,22,36H2,1H3,(H,39,40,41,43)/b37-21+,42-31? |
| InChIKey | GIWPRTHIYILUGY-FUUARBBRSA-N |
| XLogP | 5.24 |
| TPSA | 160.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|