C17H8B6N4S — CID 174113155
CID 174113155 (PubChem CID 174113155) has the molecular formula C17H8B6N4S and a molecular weight of 365.22 g/mol.
| Compound Name | CID 174113155 |
|---|---|
| PubChem CID | 174113155 |
| Molecular Formula | C17H8B6N4S |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])c1cc(-c2sc(N)nc2-c2cccc(C#N)c2)cc(C([B])([B])[B])n1 |
| InChI | InChI=1S/C17H8B6N4S/c18-16(19,20)11-5-10(6-12(26-11)17(21,22)23)14-13(27-15(25)28-14)9-3-1-2-8(4-9)7-24/h1-6H,(H2,25,27) |
| InChIKey | OPFFVBPPQMPZMW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|