C25H22N2O5 — CID 17411442
5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-methyl-3-(2-naphthalen-1-yl-2-oxoethyl)imidazolidine-2,4-dione (PubChem CID 17411442) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-methyl-3-(2-naphthalen-1-yl-2-oxoethyl)imidazolidine-2,4-dione.
| Compound Name | 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-methyl-3-(2-naphthalen-1-yl-2-oxoethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17411442 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-methyl-3-(2-naphthalen-1-yl-2-oxoethyl)imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc3c(c2)OCCCO3)NC(=O)N(CC(=O)c2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C25H22N2O5/c1-25(17-10-11-21-22(14-17)32-13-5-12-31-21)23(29)27(24(30)26-25)15-20(28)19-9-4-7-16-6-2-3-8-18(16)19/h2-4,6-11,14H,5,12-13,15H2,1H3,(H,26,30) |
| InChIKey | VXHNOFOSXMEKNT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|