C25H22N2O3 — CID 40820459
(5S)-5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-(2-naphthalen-1-yl-2-oxoethyl)imidazolidine-2,4-dione (PubChem CID 40820459) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is (5S)-5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-(2-naphthalen-1-yl-2-oxoethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-(2-naphthalen-1-yl-2-oxoethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40820459 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (5S)-5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-(2-naphthalen-1-yl-2-oxoethyl)imidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccc3c(c2)CCC3)NC(=O)N(CC(=O)c2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C25H22N2O3/c1-25(19-13-12-16-7-4-9-18(16)14-19)23(29)27(24(30)26-25)15-22(28)21-11-5-8-17-6-2-3-10-20(17)21/h2-3,5-6,8,10-14H,4,7,9,15H2,1H3,(H,26,30)/t25-/m0/s1 |
| InChIKey | MMDDMVPEICNBSJ-VWLOTQADSA-N |
| XLogP | 3.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|