C44H33N3O — CID 174115673
2-cyclohexa-1,5-dien-1-yl-4-[3-[(1E,6Z,8Z)-5-methylidenecyclodeca-1,3,6,8-tetraen-1-yl]dibenzofuran-1-yl]-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 174115673) has the molecular formula C44H33N3O and a molecular weight of 619.77 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-4-[3-[(1E,6Z,8Z)-5-methylidenecyclodeca-1,3,6,8-tetraen-1-yl]dibenzofuran-1-yl]-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-4-[3-[(1E,6Z,8Z)-5-methylidenecyclodeca-1,3,6,8-tetraen-1-yl]dibenzofuran-1-yl]-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 174115673 |
| Molecular Formula | C44H33N3O |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-4-[3-[(1E,6Z,8Z)-5-methylidenecyclodeca-1,3,6,8-tetraen-1-yl]dibenzofuran-1-yl]-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | C=C1C=C/C=C(/c2cc(-c3nc(C4=CCCC=C4)nc(-c4ccc(-c5ccccc5)cc4)n3)c3c(c2)oc2ccccc23)C/C=C\C=C/1 |
| InChI | InChI=1S/C44H33N3O/c1-30-14-5-2-6-18-32(21-13-15-30)36-28-38(41-37-22-11-12-23-39(37)48-40(41)29-36)44-46-42(34-19-9-4-10-20-34)45-43(47-44)35-26-24-33(25-27-35)31-16-7-3-8-17-31/h2-3,5-9,11-17,19-29H,1,4,10,18H2/b6-2-,14-5-,15-13?,32-21+ |
| InChIKey | KZEPKNJTEGPNDL-CFLFKGOASA-N |
| XLogP | 11.52 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |