C25H21BClF2N5O3 — CID 174116965
CID 174116965 (PubChem CID 174116965) has the molecular formula C25H21BClF2N5O3 and a molecular weight of 523.74 g/mol.
| Compound Name | CID 174116965 |
|---|---|
| PubChem CID | 174116965 |
| Molecular Formula | C25H21BClF2N5O3 |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | — |
| SMILES | [B][C@@H](Oc1cc(C)n(-c2cc(-c3ccnc(C(C)(C)O)n3)ncc2C)c(=O)c1Cl)c1ncc(F)cc1F |
| InChI | InChI=1S/C25H21BClF2N5O3/c1-12-10-31-17(16-5-6-30-24(33-16)25(3,4)36)9-18(12)34-13(2)7-19(20(27)23(34)35)37-22(26)21-15(29)8-14(28)11-32-21/h5-11,22,36H,1-4H3/t22-/m0/s1 |
| InChIKey | UCAIZVNJSRLQAE-QFIPXVFZSA-N |
| XLogP | 4.11 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|