C39H24B4N2O — CID 174118212
CID 174118212 (PubChem CID 174118212) has the molecular formula C39H24B4N2O and a molecular weight of 579.88 g/mol.
| Compound Name | CID 174118212 |
|---|---|
| PubChem CID | 174118212 |
| Molecular Formula | C39H24B4N2O |
| Molecular Weight | 579.88 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)C([B])([B])c1nc2ccccc2n1-c1cccc(-c2c3ccccc3c(-c3ccc4ccccc4c3)c3ccccc23)c1 |
| InChI | InChI=1S/C39H24B4N2O/c40-38(41,39(42,43)46)37-44-33-18-7-8-19-34(33)45(37)28-13-9-12-26(23-28)35-29-14-3-5-16-31(29)36(32-17-6-4-15-30(32)35)27-21-20-24-10-1-2-11-25(24)22-27/h1-23,46H |
| InChIKey | AMUHBCJWLIWCEI-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.88 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|