C46H31B3N2O — CID 174118222
CID 174118222 (PubChem CID 174118222) has the molecular formula C46H31B3N2O and a molecular weight of 660.20 g/mol.
| Compound Name | CID 174118222 |
|---|---|
| PubChem CID | 174118222 |
| Molecular Formula | C46H31B3N2O |
| Molecular Weight | 660.20 g/mol |
| Exact Mass | 660.27 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)C([B])(C)c1nc2ccccc2n1-c1ccc(-c2ccc(-c3c4ccccc4c(-c4ccc5ccccc5c4)c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C46H31B3N2O/c1-45(47,46(48,49)52)44-50-40-16-8-9-17-41(40)51(44)35-26-24-31(25-27-35)30-18-21-32(22-19-30)42-36-12-4-6-14-38(36)43(39-15-7-5-13-37(39)42)34-23-20-29-10-2-3-11-33(29)28-34/h2-28,52H,1H3 |
| InChIKey | ZHEOWWGZVUNKBZ-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.20 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|