About CID 174120716
CID 174120716 (PubChem CID 174120716) has the molecular formula C45H23B5N2O
and a molecular weight of 661.75 g/mol.
Molecular Properties
| Compound Name | CID 174120716 |
| PubChem CID | 174120716 |
| Molecular Formula | C45H23B5N2O |
| Molecular Weight | 661.75 g/mol |
| Exact Mass | 662.23 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-n2c(-c3c4ccccc4c(-c4ccc5oc6ccccc6c5c4)c4cc(-c5ccccc5)ccc34)nc3ccccc32)c([B])c1[B] |
| InChI | InChI=1S/C45H23B5N2O/c46-39-40(47)42(49)44(43(50)41(39)48)52-34-16-8-7-15-33(34)51-45(52)38-29-14-5-4-13-28(29)37(32-22-25(18-20-30(32)38)24-10-2-1-3-11-24)26-19-21-36-31(23-26)27-12-6-9-17-35(27)53-36/h1-23H |
| InChIKey | MPUVCWRBTYDQJO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 661.75 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze CID 174120716 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174120716?
The IUPAC name of CID 174120716 (CID 174120716) is not available.
What is the SMILES notation for CID 174120716?
The canonical SMILES for CID 174120716 is [B]c1c([B])c([B])c(-n2c(-c3c4ccccc4c(-c4ccc5oc6ccccc6c5c4)c4cc(-c5ccccc5)ccc34)nc3ccccc32)c([B])c1[B].
What is the InChIKey of CID 174120716?
The InChIKey is MPUVCWRBTYDQJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H23B5N2O/c46-39-40(47)42(49)44(43(50)41(39)48)52-34-16-8-7-15-33(34)51-45(52)38-29-14-5-4-13-28(29)37(32-22-25(18-20-30(32)38)24-10-2-1-3-11-24)26-19-21-36-31(23-26)27-12-6-9-17-35(27)53-36/h1-23H.
What are the key properties of CID 174120716?
CID 174120716 has a molecular weight of 661.75 g/mol, XLogP of 6.20, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174120716 is sourced from PubChem (CID 174120716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).