C51H27B5N2S — CID 174120506
CID 174120506 (PubChem CID 174120506) has the molecular formula C51H27B5N2S and a molecular weight of 753.92 g/mol.
| Compound Name | CID 174120506 |
|---|---|
| PubChem CID | 174120506 |
| Molecular Formula | C51H27B5N2S |
| Molecular Weight | 753.92 g/mol |
| Exact Mass | 754.24 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-n2c(-c3cccc(-c4c5ccccc5c(-c5cccc6sc7ccccc7c56)c5cc(-c6ccccc6)ccc45)c3)nc3ccccc32)c([B])c1[B] |
| InChI | InChI=1S/C51H27B5N2S/c52-45-46(53)48(55)50(49(56)47(45)54)58-39-21-8-7-20-38(39)57-51(58)31-15-10-14-30(26-31)42-32-16-4-5-17-33(32)43(37-27-29(24-25-34(37)42)28-12-2-1-3-13-28)36-19-11-23-41-44(36)35-18-6-9-22-40(35)59-41/h1-27H |
| InChIKey | JCLCAKCYLTXNCK-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.92 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|