About CID 174124796
CID 174124796 (PubChem CID 174124796) has the molecular formula C52H49BNS2
and a molecular weight of 762.92 g/mol.
Molecular Properties
| Compound Name | CID 174124796 |
| PubChem CID | 174124796 |
| Molecular Formula | C52H49BNS2 |
| Molecular Weight | 762.92 g/mol |
| Exact Mass | 762.34 |
| IUPAC Name | — |
| SMILES | CC(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1-c1ccc2c3cc4c(cc3n3c2c1[B]c1sc2ccc(C(C)(C)C)cc2c1-3)sc1ccccc14 |
| InChI | InChI=1S/C52H49BNS2/c1-29(30-15-17-31(18-16-30)50(2,3)4)34-21-19-32(51(5,6)7)25-38(34)36-22-23-37-39-27-40-35-13-11-12-14-43(35)55-45(40)28-42(39)54-47(37)46(36)53-49-48(54)41-26-33(52(8,9)10)20-24-44(41)56-49/h11-29H,1-10H3 |
| InChIKey | SKVIIFPKDUOFOG-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 762.92 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174124796 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174124796?
The IUPAC name of CID 174124796 (CID 174124796) is not available.
What is the SMILES notation for CID 174124796?
The canonical SMILES for CID 174124796 is CC(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1-c1ccc2c3cc4c(cc3n3c2c1[B]c1sc2ccc(C(C)(C)C)cc2c1-3)sc1ccccc14.
What is the InChIKey of CID 174124796?
The InChIKey is SKVIIFPKDUOFOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C52H49BNS2/c1-29(30-15-17-31(18-16-30)50(2,3)4)34-21-19-32(51(5,6)7)25-38(34)36-22-23-37-39-27-40-35-13-11-12-14-43(35)55-45(40)28-42(39)54-47(37)46(36)53-49-48(54)41-26-33(52(8,9)10)20-24-44(41)56-49/h11-29H,1-10H3.
What are the key properties of CID 174124796?
CID 174124796 has a molecular weight of 762.92 g/mol, XLogP of 14.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174124796 is sourced from PubChem (CID 174124796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).