C22H28INO4 — CID 174132567
(1R,12S)-14-(2-hydroxyethyl)-12-(iodomethyl)-4,13-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10,13-pentaen-3-ol (PubChem CID 174132567) has the molecular formula C22H28INO4 and a molecular weight of 497.37 g/mol. Its IUPAC name is (1R,12S)-14-(2-hydroxyethyl)-12-(iodomethyl)-4,13-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10,13-pentaen-3-ol.
| Compound Name | (1R,12S)-14-(2-hydroxyethyl)-12-(iodomethyl)-4,13-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10,13-pentaen-3-ol |
|---|---|
| PubChem CID | 174132567 |
| Molecular Formula | C22H28INO4 |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | (1R,12S)-14-(2-hydroxyethyl)-12-(iodomethyl)-4,13-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10,13-pentaen-3-ol |
| SMILES | COC1=C(CCO)[C@]23CCN(C)C(Cc4ccc(OC)c(O)c42)C3=C[C@@H]1CI |
| InChI | InChI=1S/C22H28INO4/c1-24-8-7-22-15(6-9-25)21(28-3)14(12-23)10-16(22)17(24)11-13-4-5-18(27-2)20(26)19(13)22/h4-5,10,14,17,25-26H,6-9,11-12H2,1-3H3/t14-,17?,22+/m1/s1 |
| InChIKey | GMIQTXSPXQCXIJ-ZPJLEJLVSA-N |
| XLogP | 3.17 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|