C23H29NO7 — CID 21456708
[(1S,9R,12S,13S)-12-acetyloxy-3-hydroxy-4,11-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10-tetraen-13-yl] acetate (PubChem CID 21456708) has the molecular formula C23H29NO7 and a molecular weight of 431.49 g/mol. Its IUPAC name is [(1S,9R,12S,13S)-12-acetyloxy-3-hydroxy-4,11-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10-tetraen-13-yl] acetate.
| Compound Name | [(1S,9R,12S,13S)-12-acetyloxy-3-hydroxy-4,11-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10-tetraen-13-yl] acetate |
|---|---|
| PubChem CID | 21456708 |
| Molecular Formula | C23H29NO7 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | [(1S,9R,12S,13S)-12-acetyloxy-3-hydroxy-4,11-dimethoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10-tetraen-13-yl] acetate |
| SMILES | COC1=C2[C@H]3Cc4ccc(OC)c(O)c4[C@]2(CCN3C)C[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H29NO7/c1-12(25)30-17-11-23-8-9-24(3)15(19(23)22(29-5)21(17)31-13(2)26)10-14-6-7-16(28-4)20(27)18(14)23/h6-7,15,17,21,27H,8-11H2,1-5H3/t15-,17+,21+,23+/m1/s1 |
| InChIKey | ZYHWPODSLMIRCA-APXIIAQRSA-N |
| XLogP | 2.07 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |