C48H24B8N2O — CID 174134757
CID 174134757 (PubChem CID 174134757) has the molecular formula C48H24B8N2O and a molecular weight of 731.23 g/mol.
| Compound Name | CID 174134757 |
|---|---|
| PubChem CID | 174134757 |
| Molecular Formula | C48H24B8N2O |
| Molecular Weight | 731.23 g/mol |
| Exact Mass | 732.26 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c(oc3c2c(N(c2ccc(-c4ccccc4)cc2)c2ccc(-c4ccccc4)cc2)cc2c3c3c([B])c([B])c([B])c([B])c3n2-c2ccccc2)c1[B] |
| InChI | InChI=1S/C48H24B8N2O/c49-38-36-34-33(58(29-14-8-3-9-15-29)46(36)44(55)42(53)40(38)51)24-32(35-37-39(50)41(52)43(54)45(56)48(37)59-47(34)35)57(30-20-16-27(17-21-30)25-10-4-1-5-11-25)31-22-18-28(19-23-31)26-12-6-2-7-13-26/h1-24H |
| InChIKey | DEDVGLOOWYLSFL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 21.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.23 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|