C36H40BNO2 — CID 174138958
7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c]carbazole (PubChem CID 174138958) has the molecular formula C36H40BNO2 and a molecular weight of 529.53 g/mol. Its IUPAC name is 7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c]carbazole.
| Compound Name | 7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c]carbazole |
|---|---|
| PubChem CID | 174138958 |
| Molecular Formula | C36H40BNO2 |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | 7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c]carbazole |
| SMILES | CC1(C)CCC(C)(C)c2c(-n3c4ccc(B5OC(C)(C)C(C)(C)O5)cc4c4c5ccccc5ccc43)cccc21 |
| InChI | InChI=1S/C36H40BNO2/c1-33(2)20-21-34(3,4)32-27(33)14-11-15-30(32)38-28-19-17-24(37-39-35(5,6)36(7,8)40-37)22-26(28)31-25-13-10-9-12-23(25)16-18-29(31)38/h9-19,22H,20-21H2,1-8H3 |
| InChIKey | OQYLVQDKCFEADM-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|