C28H28BNO2 — CID 144831031
9-naphthalen-1-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrocarbazole (PubChem CID 144831031) has the molecular formula C28H28BNO2 and a molecular weight of 421.35 g/mol. Its IUPAC name is 9-naphthalen-1-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrocarbazole.
| Compound Name | 9-naphthalen-1-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrocarbazole |
|---|---|
| PubChem CID | 144831031 |
| Molecular Formula | C28H28BNO2 |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 9-naphthalen-1-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrocarbazole |
| SMILES | CC1(C)OB(c2ccc3c4c(n(-c5cccc6ccccc56)c3c2)=CCCC=4)OC1(C)C |
| InChI | InChI=1S/C28H28BNO2/c1-27(2)28(3,4)32-29(31-27)20-16-17-23-22-13-7-8-14-25(22)30(26(23)18-20)24-15-9-11-19-10-5-6-12-21(19)24/h5-6,9-18H,7-8H2,1-4H3 |
| InChIKey | GHFIHHHKYXJOIP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|