C24H41N3O — CID 174140038
(3R,5S,8R,9R,10S,13S,14S,17R)-17-[(2R)-1-(2-hydrazinylideneethylideneamino)propan-2-yl]-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 174140038) has the molecular formula C24H41N3O and a molecular weight of 387.61 g/mol. Its IUPAC name is (3R,5S,8R,9R,10S,13S,14S,17R)-17-[(2R)-1-(2-hydrazinylideneethylideneamino)propan-2-yl]-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5S,8R,9R,10S,13S,14S,17R)-17-[(2R)-1-(2-hydrazinylideneethylideneamino)propan-2-yl]-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 174140038 |
| Molecular Formula | C24H41N3O |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.32 |
| IUPAC Name | (3R,5S,8R,9R,10S,13S,14S,17R)-17-[(2R)-1-(2-hydrazinylideneethylideneamino)propan-2-yl]-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@H](C/N=C/C=NN)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@](C)(O)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H41N3O/c1-16(15-26-12-13-27-25)21-6-7-22-20-5-4-17-14-23(2,28)10-8-18(17)19(20)9-11-24(21,22)3/h12-13,16-22,28H,4-11,14-15,25H2,1-3H3/b26-12+,27-13?/t16-,17-,18-,19+,20+,21+,22-,23+,24+/m0/s1 |
| InChIKey | PPTZJXRHJPABMD-WRICQIMESA-N |
| XLogP | 4.66 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|