C19H17BClF4N3O6 — CID 174141523
CID 174141523 (PubChem CID 174141523) has the molecular formula C19H17BClF4N3O6 and a molecular weight of 505.62 g/mol.
| Compound Name | CID 174141523 |
|---|---|
| PubChem CID | 174141523 |
| Molecular Formula | C19H17BClF4N3O6 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | — |
| SMILES | [B]C(O)(O)c1c(-c2c(F)cccc2Cl)noc1-c1cnn(C(O)(O)CC(C)(C)O)c1C(F)(F)F |
| InChI | InChI=1S/C19H17BClF4N3O6/c1-16(2,29)7-17(30,31)28-15(19(23,24)25)8(6-26-28)14-12(18(20,32)33)13(27-34-14)11-9(21)4-3-5-10(11)22/h3-6,29-33H,7H2,1-2H3 |
| InChIKey | BPOSBPQYLYBQMT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 145.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|