C18H18AsF2N7O3 — CID 174143099
CID 174143099 (PubChem CID 174143099) has the molecular formula C18H18AsF2N7O3 and a molecular weight of 493.31 g/mol.
| Compound Name | CID 174143099 |
|---|---|
| PubChem CID | 174143099 |
| Molecular Formula | C18H18AsF2N7O3 |
| Molecular Weight | 493.31 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | — |
| SMILES | COc1cc(Nc2cc([As])nc(C(F)F)n2)ncc1-c1cnn(CCN(C)C(=O)O)c1 |
| InChI | InChI=1S/C18H18AsF2N7O3/c1-27(18(29)30)3-4-28-9-10(7-23-28)11-8-22-14(5-12(11)31-2)25-15-6-13(19)24-17(26-15)16(20)21/h5-9,16H,3-4H2,1-2H3,(H,29,30)(H,22,24,25,26) |
| InChIKey | KXBFGDKVTHLWKZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|