C21H22N2O4 — CID 174143781
N-[2-(1-benzofuran-3-yl)ethyl]-N'-[(3-methoxyphenyl)methyl]propanediamide (PubChem CID 174143781) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is N-[2-(1-benzofuran-3-yl)ethyl]-N'-[(3-methoxyphenyl)methyl]propanediamide.
| Compound Name | N-[2-(1-benzofuran-3-yl)ethyl]-N'-[(3-methoxyphenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 174143781 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[2-(1-benzofuran-3-yl)ethyl]-N'-[(3-methoxyphenyl)methyl]propanediamide |
| SMILES | COc1cccc(CNC(=O)CC(=O)NCCc2coc3ccccc23)c1 |
| InChI | InChI=1S/C21H22N2O4/c1-26-17-6-4-5-15(11-17)13-23-21(25)12-20(24)22-10-9-16-14-27-19-8-3-2-7-18(16)19/h2-8,11,14H,9-10,12-13H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | FMTIWVLDJIRRPQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|