C35H55N3O7Si — CID 174145059
methyl 7-[[1-[(2S,4R)-2-[[2-[tert-butyl(dimethyl)silyl]oxy-1-(4-ethynylphenyl)ethyl]carbamoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]amino]-7-oxoheptanoate (PubChem CID 174145059) has the molecular formula C35H55N3O7Si and a molecular weight of 657.93 g/mol. Its IUPAC name is methyl 7-[[1-[(2S,4R)-2-[[2-[tert-butyl(dimethyl)silyl]oxy-1-(4-ethynylphenyl)ethyl]carbamoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]amino]-7-oxoheptanoate.
| Compound Name | methyl 7-[[1-[(2S,4R)-2-[[2-[tert-butyl(dimethyl)silyl]oxy-1-(4-ethynylphenyl)ethyl]carbamoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]amino]-7-oxoheptanoate |
|---|---|
| PubChem CID | 174145059 |
| Molecular Formula | C35H55N3O7Si |
| Molecular Weight | 657.93 g/mol |
| Exact Mass | 657.38 |
| IUPAC Name | methyl 7-[[1-[(2S,4R)-2-[[2-[tert-butyl(dimethyl)silyl]oxy-1-(4-ethynylphenyl)ethyl]carbamoyl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]amino]-7-oxoheptanoate |
| SMILES | C#Cc1ccc(C(CO[Si](C)(C)C(C)(C)C)NC(=O)[C@@H]2C[C@@H](O)CN2C(=O)C(NC(=O)CCCCCC(=O)OC)C(C)(C)C)cc1 |
| InChI | InChI=1S/C35H55N3O7Si/c1-11-24-17-19-25(20-18-24)27(23-45-46(9,10)35(5,6)7)36-32(42)28-21-26(39)22-38(28)33(43)31(34(2,3)4)37-29(40)15-13-12-14-16-30(41)44-8/h1,17-20,26-28,31,39H,12-16,21-23H2,2-10H3,(H,36,42)(H,37,40)/t26-,27?,28+,31?/m1/s1 |
| InChIKey | YTEWFTFCNXMGCC-NXLREQKESA-N |
| XLogP | 4.46 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.93 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|