C19H34N3O2Si — CID 174145399
CID 174145399 (PubChem CID 174145399) has the molecular formula C19H34N3O2Si and a molecular weight of 364.59 g/mol.
| Compound Name | CID 174145399 |
|---|---|
| PubChem CID | 174145399 |
| Molecular Formula | C19H34N3O2Si |
| Molecular Weight | 364.59 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | — |
| SMILES | COc1cc(N2CCN(C)CC2)c(C(O[Si](C)C)C(C)(C)C)cc1N |
| InChI | InChI=1S/C19H34N3O2Si/c1-19(2,3)18(24-25(6)7)14-12-15(20)17(23-5)13-16(14)22-10-8-21(4)9-11-22/h12-13,18H,8-11,20H2,1-7H3 |
| InChIKey | LOXQOZRGRLZDTP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|