C18H11Cl2F4N7O — CID 174146868
2-(aminomethylidene)-3-(2-chloro-5-fluorophenyl)imino-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-4,4,4-trifluorobutanamide (PubChem CID 174146868) has the molecular formula C18H11Cl2F4N7O and a molecular weight of 488.23 g/mol. Its IUPAC name is 2-(aminomethylidene)-3-(2-chloro-5-fluorophenyl)imino-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-4,4,4-trifluorobutanamide.
| Compound Name | 2-(aminomethylidene)-3-(2-chloro-5-fluorophenyl)imino-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 174146868 |
| Molecular Formula | C18H11Cl2F4N7O |
| Molecular Weight | 488.23 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | 2-(aminomethylidene)-3-(2-chloro-5-fluorophenyl)imino-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-4,4,4-trifluorobutanamide |
| SMILES | NC=C(C(=O)Nc1cnc(-n2nccn2)c(Cl)c1)/C(=N/c1cc(F)ccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C18H11Cl2F4N7O/c19-12-2-1-9(21)5-14(12)30-15(18(22,23)24)11(7-25)17(32)29-10-6-13(20)16(26-8-10)31-27-3-4-28-31/h1-8H,25H2,(H,29,32)/b11-7?,30-15- |
| InChIKey | GRSVVWBSORWQSM-SJZOJIFCSA-N |
| XLogP | 4.22 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|