About 2-bromopropan-2-yl 4-methoxysilylbutanoate
2-bromopropan-2-yl 4-methoxysilylbutanoate (PubChem CID 174147608) has the molecular formula C8H17BrO3Si
and a molecular weight of 269.21 g/mol. Its IUPAC name is 2-bromopropan-2-yl 4-methoxysilylbutanoate.
Molecular Properties
| Compound Name | 2-bromopropan-2-yl 4-methoxysilylbutanoate |
| PubChem CID | 174147608 |
| Molecular Formula | C8H17BrO3Si |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-bromopropan-2-yl 4-methoxysilylbutanoate |
| SMILES | CO[SiH2]CCCC(=O)OC(C)(C)Br |
| InChI | InChI=1S/C8H17BrO3Si/c1-8(2,9)12-7(10)5-4-6-13-11-3/h4-6,13H2,1-3H3 |
| InChIKey | STQHNQPMBXZSJC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopropan-2-yl 4-methoxysilylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopropan-2-yl 4-methoxysilylbutanoate?
The IUPAC name of 2-bromopropan-2-yl 4-methoxysilylbutanoate (CID 174147608) is 2-bromopropan-2-yl 4-methoxysilylbutanoate.
What is the SMILES notation for 2-bromopropan-2-yl 4-methoxysilylbutanoate?
The canonical SMILES for 2-bromopropan-2-yl 4-methoxysilylbutanoate is CO[SiH2]CCCC(=O)OC(C)(C)Br.
What is the InChIKey of 2-bromopropan-2-yl 4-methoxysilylbutanoate?
The InChIKey is STQHNQPMBXZSJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17BrO3Si/c1-8(2,9)12-7(10)5-4-6-13-11-3/h4-6,13H2,1-3H3.
What are the key properties of 2-bromopropan-2-yl 4-methoxysilylbutanoate?
2-bromopropan-2-yl 4-methoxysilylbutanoate has a molecular weight of 269.21 g/mol, XLogP of 1.59, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopropan-2-yl 4-methoxysilylbutanoate is sourced from PubChem (CID 174147608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).