C23H19B2FN3O4 — CID 174152229
CID 174152229 (PubChem CID 174152229) has the molecular formula C23H19B2FN3O4 and a molecular weight of 442.04 g/mol.
| Compound Name | CID 174152229 |
|---|---|
| PubChem CID | 174152229 |
| Molecular Formula | C23H19B2FN3O4 |
| Molecular Weight | 442.04 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | — |
| SMILES | [B][B]c1c(F)cc2nc3c(c4c2c1CCC4N)Cn1c-3cc2c(c1=O)COC(=O)C2(O)CC |
| InChI | InChI=1S/C23H19B2FN3O4/c1-2-23(32)12-5-16-20-10(7-29(16)21(30)11(12)8-33-22(23)31)17-14(27)4-3-9-18(17)15(28-20)6-13(26)19(9)25-24/h5-6,14,32H,2-4,7-8,27H2,1H3 |
| InChIKey | NDCFOWPIFAKALW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.04 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|